C10H12N2O4 — CID 106671277
3-(3,4-dihydroxypyrrolidine-1-carbonyl)-1H-pyridin-2-one (PubChem CID 106671277) has the molecular formula C10H12N2O4 and a molecular weight of 224.22 g/mol. Its IUPAC name is 3-(3,4-dihydroxypyrrolidine-1-carbonyl)-1H-pyridin-2-one.
| Compound Name | 3-(3,4-dihydroxypyrrolidine-1-carbonyl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 106671277 |
| Molecular Formula | C10H12N2O4 |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | 3-(3,4-dihydroxypyrrolidine-1-carbonyl)-1H-pyridin-2-one |
| SMILES | O=C(c1ccc[nH]c1=O)N1CC(O)C(O)C1 |
| InChI | InChI=1S/C10H12N2O4/c13-7-4-12(5-8(7)14)10(16)6-2-1-3-11-9(6)15/h1-3,7-8,13-14H,4-5H2,(H,11,15) |
| InChIKey | ICNCILGBCYIVAT-UHFFFAOYSA-N |
| XLogP | -1.45 |
| TPSA | 93.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |