C12H13NO5 — CID 107214692
2-[(3S,4R)-3,4-dihydroxypyrrolidine-1-carbonyl]benzoic acid (PubChem CID 107214692) has the molecular formula C12H13NO5 and a molecular weight of 251.24 g/mol. Its IUPAC name is 2-[(3S,4R)-3,4-dihydroxypyrrolidine-1-carbonyl]benzoic acid.
| Compound Name | 2-[(3S,4R)-3,4-dihydroxypyrrolidine-1-carbonyl]benzoic acid |
|---|---|
| PubChem CID | 107214692 |
| Molecular Formula | C12H13NO5 |
| Molecular Weight | 251.24 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | 2-[(3S,4R)-3,4-dihydroxypyrrolidine-1-carbonyl]benzoic acid |
| SMILES | O=C(O)c1ccccc1C(=O)N1C[C@@H](O)[C@@H](O)C1 |
| InChI | InChI=1S/C12H13NO5/c14-9-5-13(6-10(9)15)11(16)7-3-1-2-4-8(7)12(17)18/h1-4,9-10,14-15H,5-6H2,(H,17,18)/t9-,10+ |
| InChIKey | HVFLDKHOEHISKD-AOOOYVTPSA-N |
| XLogP | -0.44 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.24 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |