About 5-(3,4-dihydroxypyrrolidine-1-carbonyl)thiophene-2-carboxylic acid
5-(3,4-dihydroxypyrrolidine-1-carbonyl)thiophene-2-carboxylic acid (PubChem CID 106670963) has the molecular formula C10H11NO5S
and a molecular weight of 257.27 g/mol. Its IUPAC name is 5-(3,4-dihydroxypyrrolidine-1-carbonyl)thiophene-2-carboxylic acid.
Molecular Properties
| Compound Name | 5-(3,4-dihydroxypyrrolidine-1-carbonyl)thiophene-2-carboxylic acid |
| PubChem CID | 106670963 |
| Molecular Formula | C10H11NO5S |
| Molecular Weight | 257.27 g/mol |
| Exact Mass | 257.04 |
| IUPAC Name | 5-(3,4-dihydroxypyrrolidine-1-carbonyl)thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(C(=O)N2CC(O)C(O)C2)s1 |
| InChI | InChI=1S/C10H11NO5S/c12-5-3-11(4-6(5)13)9(14)7-1-2-8(17-7)10(15)16/h1-2,5-6,12-13H,3-4H2,(H,15,16) |
| InChIKey | CHXOVOUFSFCION-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.27 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(3,4-dihydroxypyrrolidine-1-carbonyl)thiophene-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3,4-dihydroxypyrrolidine-1-carbonyl)thiophene-2-carboxylic acid?
The IUPAC name of 5-(3,4-dihydroxypyrrolidine-1-carbonyl)thiophene-2-carboxylic acid (CID 106670963) is 5-(3,4-dihydroxypyrrolidine-1-carbonyl)thiophene-2-carboxylic acid.
What is the SMILES notation for 5-(3,4-dihydroxypyrrolidine-1-carbonyl)thiophene-2-carboxylic acid?
The canonical SMILES for 5-(3,4-dihydroxypyrrolidine-1-carbonyl)thiophene-2-carboxylic acid is O=C(O)c1ccc(C(=O)N2CC(O)C(O)C2)s1.
What is the InChIKey of 5-(3,4-dihydroxypyrrolidine-1-carbonyl)thiophene-2-carboxylic acid?
The InChIKey is CHXOVOUFSFCION-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO5S/c12-5-3-11(4-6(5)13)9(14)7-1-2-8(17-7)10(15)16/h1-2,5-6,12-13H,3-4H2,(H,15,16).
What are the key properties of 5-(3,4-dihydroxypyrrolidine-1-carbonyl)thiophene-2-carboxylic acid?
5-(3,4-dihydroxypyrrolidine-1-carbonyl)thiophene-2-carboxylic acid has a molecular weight of 257.27 g/mol, XLogP of -0.38, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,4-dihydroxypyrrolidine-1-carbonyl)thiophene-2-carboxylic acid is sourced from PubChem (CID 106670963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).