C13H14N2O3 — CID 106671264
(3,4-dihydroxypyrrolidin-1-yl)-(1H-indol-7-yl)methanone (PubChem CID 106671264) has the molecular formula C13H14N2O3 and a molecular weight of 246.27 g/mol. Its IUPAC name is (3,4-dihydroxypyrrolidin-1-yl)-(1H-indol-7-yl)methanone.
| Compound Name | (3,4-dihydroxypyrrolidin-1-yl)-(1H-indol-7-yl)methanone |
|---|---|
| PubChem CID | 106671264 |
| Molecular Formula | C13H14N2O3 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | (3,4-dihydroxypyrrolidin-1-yl)-(1H-indol-7-yl)methanone |
| SMILES | O=C(c1cccc2cc[nH]c12)N1CC(O)C(O)C1 |
| InChI | InChI=1S/C13H14N2O3/c16-10-6-15(7-11(10)17)13(18)9-3-1-2-8-4-5-14-12(8)9/h1-5,10-11,14,16-17H,6-7H2 |
| InChIKey | PYQAJCBWURYMRQ-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 76.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |