C18H18N2O2S — CID 124592372
1H-indol-7-yl-[(2S,6R)-2-methyl-6-thiophen-3-ylmorpholin-4-yl]methanone (PubChem CID 124592372) has the molecular formula C18H18N2O2S and a molecular weight of 326.42 g/mol. Its IUPAC name is 1H-indol-7-yl-[(2S,6R)-2-methyl-6-thiophen-3-ylmorpholin-4-yl]methanone.
| Compound Name | 1H-indol-7-yl-[(2S,6R)-2-methyl-6-thiophen-3-ylmorpholin-4-yl]methanone |
|---|---|
| PubChem CID | 124592372 |
| Molecular Formula | C18H18N2O2S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | 1H-indol-7-yl-[(2S,6R)-2-methyl-6-thiophen-3-ylmorpholin-4-yl]methanone |
| SMILES | C[C@H]1CN(C(=O)c2cccc3cc[nH]c23)C[C@@H](c2ccsc2)O1 |
| InChI | InChI=1S/C18H18N2O2S/c1-12-9-20(10-16(22-12)14-6-8-23-11-14)18(21)15-4-2-3-13-5-7-19-17(13)15/h2-8,11-12,16,19H,9-10H2,1H3/t12-,16-/m0/s1 |
| InChIKey | UEPFKSWOHJUZDP-LRDDRELGSA-N |
| XLogP | 3.83 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |