C19H18N2O3 — CID 97233500
[(2R)-2-(3-hydroxyphenyl)morpholin-4-yl]-(1H-indol-7-yl)methanone (PubChem CID 97233500) has the molecular formula C19H18N2O3 and a molecular weight of 322.36 g/mol. Its IUPAC name is [(2R)-2-(3-hydroxyphenyl)morpholin-4-yl]-(1H-indol-7-yl)methanone.
| Compound Name | [(2R)-2-(3-hydroxyphenyl)morpholin-4-yl]-(1H-indol-7-yl)methanone |
|---|---|
| PubChem CID | 97233500 |
| Molecular Formula | C19H18N2O3 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | [(2R)-2-(3-hydroxyphenyl)morpholin-4-yl]-(1H-indol-7-yl)methanone |
| SMILES | O=C(c1cccc2cc[nH]c12)N1CCO[C@H](c2cccc(O)c2)C1 |
| InChI | InChI=1S/C19H18N2O3/c22-15-5-1-4-14(11-15)17-12-21(9-10-24-17)19(23)16-6-2-3-13-7-8-20-18(13)16/h1-8,11,17,20,22H,9-10,12H2/t17-/m0/s1 |
| InChIKey | KGHNWAFWWKTVIL-KRWDZBQOSA-N |
| XLogP | 3.09 |
| TPSA | 65.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |