C19H20N2O4 — CID 127904119
6-cyclopropyl-4-[2-(3-hydroxyphenyl)morpholine-4-carbonyl]-1H-pyridin-2-one (PubChem CID 127904119) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is 6-cyclopropyl-4-[2-(3-hydroxyphenyl)morpholine-4-carbonyl]-1H-pyridin-2-one.
| Compound Name | 6-cyclopropyl-4-[2-(3-hydroxyphenyl)morpholine-4-carbonyl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 127904119 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | 6-cyclopropyl-4-[2-(3-hydroxyphenyl)morpholine-4-carbonyl]-1H-pyridin-2-one |
| SMILES | O=C(c1cc(C2CC2)[nH]c(=O)c1)N1CCOC(c2cccc(O)c2)C1 |
| InChI | InChI=1S/C19H20N2O4/c22-15-3-1-2-13(8-15)17-11-21(6-7-25-17)19(24)14-9-16(12-4-5-12)20-18(23)10-14/h1-3,8-10,12,17,22H,4-7,11H2,(H,20,23) |
| InChIKey | BYACGNYORIYAFP-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 82.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |