C17H15F2NO3 — CID 124618948
[(2S)-2-(2,4-difluorophenyl)morpholin-4-yl]-(3-hydroxyphenyl)methanone (PubChem CID 124618948) has the molecular formula C17H15F2NO3 and a molecular weight of 319.31 g/mol. Its IUPAC name is [(2S)-2-(2,4-difluorophenyl)morpholin-4-yl]-(3-hydroxyphenyl)methanone.
| Compound Name | [(2S)-2-(2,4-difluorophenyl)morpholin-4-yl]-(3-hydroxyphenyl)methanone |
|---|---|
| PubChem CID | 124618948 |
| Molecular Formula | C17H15F2NO3 |
| Molecular Weight | 319.31 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | [(2S)-2-(2,4-difluorophenyl)morpholin-4-yl]-(3-hydroxyphenyl)methanone |
| SMILES | O=C(c1cccc(O)c1)N1CCO[C@@H](c2ccc(F)cc2F)C1 |
| InChI | InChI=1S/C17H15F2NO3/c18-12-4-5-14(15(19)9-12)16-10-20(6-7-23-16)17(22)11-2-1-3-13(21)8-11/h1-5,8-9,16,21H,6-7,10H2/t16-/m1/s1 |
| InChIKey | CDTKZLKVFXREJA-MRXNPFEDSA-N |
| XLogP | 2.88 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.31 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |