C21H20F2N2O3 — CID 166414107
N-[4-[2-(2,4-difluorophenyl)morpholine-4-carbonyl]phenyl]-N-methylprop-2-enamide (PubChem CID 166414107) has the molecular formula C21H20F2N2O3 and a molecular weight of 386.40 g/mol. Its IUPAC name is N-[4-[2-(2,4-difluorophenyl)morpholine-4-carbonyl]phenyl]-N-methylprop-2-enamide.
| Compound Name | N-[4-[2-(2,4-difluorophenyl)morpholine-4-carbonyl]phenyl]-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 166414107 |
| Molecular Formula | C21H20F2N2O3 |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | N-[4-[2-(2,4-difluorophenyl)morpholine-4-carbonyl]phenyl]-N-methylprop-2-enamide |
| SMILES | C=CC(=O)N(C)c1ccc(C(=O)N2CCOC(c3ccc(F)cc3F)C2)cc1 |
| InChI | InChI=1S/C21H20F2N2O3/c1-3-20(26)24(2)16-7-4-14(5-8-16)21(27)25-10-11-28-19(13-25)17-9-6-15(22)12-18(17)23/h3-9,12,19H,1,10-11,13H2,2H3 |
| InChIKey | YWXCPSGBWXFLPT-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|