C18H15F2N3O2S — CID 126783807
N-(1,3-benzothiazol-2-yl)-2-(2,4-difluorophenyl)morpholine-4-carboxamide (PubChem CID 126783807) has the molecular formula C18H15F2N3O2S and a molecular weight of 375.40 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-2-(2,4-difluorophenyl)morpholine-4-carboxamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-2-(2,4-difluorophenyl)morpholine-4-carboxamide |
|---|---|
| PubChem CID | 126783807 |
| Molecular Formula | C18H15F2N3O2S |
| Molecular Weight | 375.40 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-2-(2,4-difluorophenyl)morpholine-4-carboxamide |
| SMILES | O=C(Nc1nc2ccccc2s1)N1CCOC(c2ccc(F)cc2F)C1 |
| InChI | InChI=1S/C18H15F2N3O2S/c19-11-5-6-12(13(20)9-11)15-10-23(7-8-25-15)18(24)22-17-21-14-3-1-2-4-16(14)26-17/h1-6,9,15H,7-8,10H2,(H,21,22,24) |
| InChIKey | OCIHSROEWVGWDN-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.40 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |