C13H14N4O2S2 — CID 172824956
N-(1,3-benzothiazol-2-yl)morpholine-4-carboxamide;thiocyanic acid (PubChem CID 172824956) has the molecular formula C13H14N4O2S2 and a molecular weight of 322.41 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)morpholine-4-carboxamide;thiocyanic acid.
| Compound Name | N-(1,3-benzothiazol-2-yl)morpholine-4-carboxamide;thiocyanic acid |
|---|---|
| PubChem CID | 172824956 |
| Molecular Formula | C13H14N4O2S2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)morpholine-4-carboxamide;thiocyanic acid |
| SMILES | N#CS.O=C(Nc1nc2ccccc2s1)N1CCOCC1 |
| InChI | InChI=1S/C12H13N3O2S.CHNS/c16-12(15-5-7-17-8-6-15)14-11-13-9-3-1-2-4-10(9)18-11;2-1-3/h1-4H,5-8H2,(H,13,14,16);3H |
| InChIKey | USRVGLKIZQPYLD-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 78.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|