C17H18N4OS — CID 75418516
N-(1,3-benzothiazol-2-yl)-4-pyrrol-1-ylpiperidine-1-carboxamide (PubChem CID 75418516) has the molecular formula C17H18N4OS and a molecular weight of 326.43 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-4-pyrrol-1-ylpiperidine-1-carboxamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-4-pyrrol-1-ylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 75418516 |
| Molecular Formula | C17H18N4OS |
| Molecular Weight | 326.43 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-4-pyrrol-1-ylpiperidine-1-carboxamide |
| SMILES | O=C(Nc1nc2ccccc2s1)N1CCC(n2cccc2)CC1 |
| InChI | InChI=1S/C17H18N4OS/c22-17(19-16-18-14-5-1-2-6-15(14)23-16)21-11-7-13(8-12-21)20-9-3-4-10-20/h1-6,9-10,13H,7-8,11-12H2,(H,18,19,22) |
| InChIKey | FXJDAJJMFMAGLF-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.43 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |