C12H19N3 — CID 136624467
ethane;N,5,5-trimethyl-6H-pyrrolo[3,4-b]pyridin-7-imine (PubChem CID 136624467) has the molecular formula C12H19N3 and a molecular weight of 205.30 g/mol. Its IUPAC name is ethane;N,5,5-trimethyl-6H-pyrrolo[3,4-b]pyridin-7-imine.
| Compound Name | ethane;N,5,5-trimethyl-6H-pyrrolo[3,4-b]pyridin-7-imine |
|---|---|
| PubChem CID | 136624467 |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | ethane;N,5,5-trimethyl-6H-pyrrolo[3,4-b]pyridin-7-imine |
| SMILES | C/N=C1\NC(C)(C)c2cccnc21.CC |
| InChI | InChI=1S/C10H13N3.C2H6/c1-10(2)7-5-4-6-12-8(7)9(11-3)13-10;1-2/h4-6H,1-3H3,(H,11,13);1-2H3 |
| InChIKey | LLFHUJZFFXXDDZ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|