C28H24BeN2O2 — CID 58049972
beryllium bis(5,5-dimethylindeno[1,2-b]pyridin-9-olate) (PubChem CID 58049972) has the molecular formula C28H24BeN2O2 and a molecular weight of 429.52 g/mol. Its IUPAC name is beryllium bis(5,5-dimethylindeno[1,2-b]pyridin-9-olate).
| Compound Name | beryllium bis(5,5-dimethylindeno[1,2-b]pyridin-9-olate) |
|---|---|
| PubChem CID | 58049972 |
| Molecular Formula | C28H24BeN2O2 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.20 |
| IUPAC Name | beryllium bis(5,5-dimethylindeno[1,2-b]pyridin-9-olate) |
| SMILES | CC1(C)c2cccnc2-c2c([O-])cccc21.CC1(C)c2cccnc2-c2c([O-])cccc21.[Be+2] |
| InChI | InChI=1S/2C14H13NO.Be/c2*1-14(2)9-5-3-7-11(16)12(9)13-10(14)6-4-8-15-13;/h2*3-8,16H,1-2H3;/q;;+2/p-2 |
| InChIKey | PNNUXWKOULPHIJ-UHFFFAOYSA-L |
| XLogP | 4.54 |
| TPSA | 71.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |