C23H23N3 — CID 170363520
5,6,9,9,20,20-hexamethyl-4,7,15-triazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),2(10),3,5,7,11,14(19),15,17-nonaene (PubChem CID 170363520) has the molecular formula C23H23N3 and a molecular weight of 341.46 g/mol. Its IUPAC name is 5,6,9,9,20,20-hexamethyl-4,7,15-triazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),2(10),3,5,7,11,14(19),15,17-nonaene.
| Compound Name | 5,6,9,9,20,20-hexamethyl-4,7,15-triazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),2(10),3,5,7,11,14(19),15,17-nonaene |
|---|---|
| PubChem CID | 170363520 |
| Molecular Formula | C23H23N3 |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | 5,6,9,9,20,20-hexamethyl-4,7,15-triazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),2(10),3,5,7,11,14(19),15,17-nonaene |
| SMILES | Cc1nc2c(nc1C)C(C)(C)c1ccc3c(c1-2)C(C)(C)c1cccnc1-3 |
| InChI | InChI=1S/C23H23N3/c1-12-13(2)26-21-20(25-12)17-15(23(21,5)6)10-9-14-18(17)22(3,4)16-8-7-11-24-19(14)16/h7-11H,1-6H3 |
| InChIKey | HUHXKHMWONEWTF-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |