C19H15N3O — CID 170363195
5,20,20-trimethyl-9-oxa-4,6,15-triazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),2(10),3,5,7,11,14(19),15,17-nonaene (PubChem CID 170363195) has the molecular formula C19H15N3O and a molecular weight of 301.35 g/mol. Its IUPAC name is 5,20,20-trimethyl-9-oxa-4,6,15-triazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),2(10),3,5,7,11,14(19),15,17-nonaene.
| Compound Name | 5,20,20-trimethyl-9-oxa-4,6,15-triazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),2(10),3,5,7,11,14(19),15,17-nonaene |
|---|---|
| PubChem CID | 170363195 |
| Molecular Formula | C19H15N3O |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 5,20,20-trimethyl-9-oxa-4,6,15-triazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),2(10),3,5,7,11,14(19),15,17-nonaene |
| SMILES | Cc1ncc2oc3ccc4c(c3c2n1)C(C)(C)c1cccnc1-4 |
| InChI | InChI=1S/C19H15N3O/c1-10-21-9-14-18(22-10)15-13(23-14)7-6-11-16(15)19(2,3)12-5-4-8-20-17(11)12/h4-9H,1-3H3 |
| InChIKey | ARKJJFBFWDBBTK-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |