C25H27NSi — CID 174147918
9,9,20,20-tetramethyl-5-propan-2-yl-15-aza-9-silapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),2(10),3(8),4,6,11,14(19),15,17-nonaene (PubChem CID 174147918) has the molecular formula C25H27NSi and a molecular weight of 369.58 g/mol. Its IUPAC name is 9,9,20,20-tetramethyl-5-propan-2-yl-15-aza-9-silapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),2(10),3(8),4,6,11,14(19),15,17-nonaene.
| Compound Name | 9,9,20,20-tetramethyl-5-propan-2-yl-15-aza-9-silapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),2(10),3(8),4,6,11,14(19),15,17-nonaene |
|---|---|
| PubChem CID | 174147918 |
| Molecular Formula | C25H27NSi |
| Molecular Weight | 369.58 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | 9,9,20,20-tetramethyl-5-propan-2-yl-15-aza-9-silapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),2(10),3(8),4,6,11,14(19),15,17-nonaene |
| SMILES | CC(C)c1ccc2c(c1)-c1c(ccc3c1C(C)(C)c1cccnc1-3)[Si]2(C)C |
| InChI | InChI=1S/C25H27NSi/c1-15(2)16-9-11-20-18(14-16)22-21(27(20,5)6)12-10-17-23(22)25(3,4)19-8-7-13-26-24(17)19/h7-15H,1-6H3 |
| InChIKey | PZCCGZDKDQBNHL-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.58 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|