C27H23N3 — CID 59747241
4-(5,5-dimethylindeno[1,2-b]pyridin-2-yl)-8,8-dimethyl-3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene (PubChem CID 59747241) has the molecular formula C27H23N3 and a molecular weight of 389.50 g/mol. Its IUPAC name is 4-(5,5-dimethylindeno[1,2-b]pyridin-2-yl)-8,8-dimethyl-3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene.
| Compound Name | 4-(5,5-dimethylindeno[1,2-b]pyridin-2-yl)-8,8-dimethyl-3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
|---|---|
| PubChem CID | 59747241 |
| Molecular Formula | C27H23N3 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | 4-(5,5-dimethylindeno[1,2-b]pyridin-2-yl)-8,8-dimethyl-3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
| SMILES | CC1(C)c2ccccc2-c2nc(-c3ccc4c(n3)-c3ncccc3C4(C)C)ccc21 |
| InChI | InChI=1S/C27H23N3/c1-26(2)17-9-6-5-8-16(17)23-19(26)11-13-21(29-23)22-14-12-20-25(30-22)24-18(27(20,3)4)10-7-15-28-24/h5-15H,1-4H3 |
| InChIKey | UHIZCNLPJMXGPW-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |