C62H50N4 — CID 59747186
5,5-dimethyl-2-[2,4,5-tris(5,5-dimethylindeno[1,2-b]pyridin-2-yl)phenyl]indeno[1,2-b]pyridine (PubChem CID 59747186) has the molecular formula C62H50N4 and a molecular weight of 851.11 g/mol. Its IUPAC name is 5,5-dimethyl-2-[2,4,5-tris(5,5-dimethylindeno[1,2-b]pyridin-2-yl)phenyl]indeno[1,2-b]pyridine.
| Compound Name | 5,5-dimethyl-2-[2,4,5-tris(5,5-dimethylindeno[1,2-b]pyridin-2-yl)phenyl]indeno[1,2-b]pyridine |
|---|---|
| PubChem CID | 59747186 |
| Molecular Formula | C62H50N4 |
| Molecular Weight | 851.11 g/mol |
| Exact Mass | 850.40 |
| IUPAC Name | 5,5-dimethyl-2-[2,4,5-tris(5,5-dimethylindeno[1,2-b]pyridin-2-yl)phenyl]indeno[1,2-b]pyridine |
| SMILES | CC1(C)c2ccccc2-c2nc(-c3cc(-c4ccc5c(n4)-c4ccccc4C5(C)C)c(-c4ccc5c(n4)-c4ccccc4C5(C)C)cc3-c3ccc4c(n3)-c3ccccc3C4(C)C)ccc21 |
| InChI | InChI=1S/C62H50N4/c1-59(2)43-21-13-9-17-35(43)55-47(59)25-29-51(63-55)39-33-41(53-31-27-49-57(65-53)37-19-11-15-23-45(37)61(49,5)6)42(54-32-28-50-58(66-54)38-20-12-16-24-46(38)62(50,7)8)34-40(39)52-30-26-48-56(64-52)36-18-10-14-22-44(36)60(48,3)4/h9-34H,1-8H3 |
| InChIKey | IQSZNZFTQLVYPU-UHFFFAOYSA-N |
| XLogP | 15.16 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 851.11 |
| LogP ≤ 5 | 15.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |