About formaldehyde;4,5,6,7-tetrahydrothieno[3,2-c]pyridine
formaldehyde;4,5,6,7-tetrahydrothieno[3,2-c]pyridine (PubChem CID 143247723) has the molecular formula C8H11NOS
and a molecular weight of 169.25 g/mol. Its IUPAC name is formaldehyde;4,5,6,7-tetrahydrothieno[3,2-c]pyridine.
Analyze formaldehyde;4,5,6,7-tetrahydrothieno[3,2-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formaldehyde;4,5,6,7-tetrahydrothieno[3,2-c]pyridine?
The IUPAC name of formaldehyde;4,5,6,7-tetrahydrothieno[3,2-c]pyridine (CID 143247723) is formaldehyde;4,5,6,7-tetrahydrothieno[3,2-c]pyridine.
What is the SMILES notation for formaldehyde;4,5,6,7-tetrahydrothieno[3,2-c]pyridine?
The canonical SMILES for formaldehyde;4,5,6,7-tetrahydrothieno[3,2-c]pyridine is C=O.c1cc2c(s1)CCNC2.
What is the InChIKey of formaldehyde;4,5,6,7-tetrahydrothieno[3,2-c]pyridine?
The InChIKey is VQPKKNMWVYIJDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NS.CH2O/c1-3-8-5-6-2-4-9-7(1)6;1-2/h2,4,8H,1,3,5H2;1H2.
What are the key properties of formaldehyde;4,5,6,7-tetrahydrothieno[3,2-c]pyridine?
formaldehyde;4,5,6,7-tetrahydrothieno[3,2-c]pyridine has a molecular weight of 169.25 g/mol, XLogP of 1.21, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for formaldehyde;4,5,6,7-tetrahydrothieno[3,2-c]pyridine is sourced from PubChem (CID 143247723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).