C14H26S — CID 144580255
butane;ethane;4,5,6,7-tetrahydro-1-benzothiophene (PubChem CID 144580255) has the molecular formula C14H26S and a molecular weight of 226.43 g/mol. Its IUPAC name is butane;ethane;4,5,6,7-tetrahydro-1-benzothiophene.
| Compound Name | butane;ethane;4,5,6,7-tetrahydro-1-benzothiophene |
|---|---|
| PubChem CID | 144580255 |
| Molecular Formula | C14H26S |
| Molecular Weight | 226.43 g/mol |
| Exact Mass | 226.18 |
| IUPAC Name | butane;ethane;4,5,6,7-tetrahydro-1-benzothiophene |
| SMILES | CC.CCCC.c1cc2c(s1)CCCC2 |
| InChI | InChI=1S/C8H10S.C4H10.C2H6/c1-2-4-8-7(3-1)5-6-9-8;1-3-4-2;1-2/h5-6H,1-4H2;3-4H2,1-2H3;1-2H3 |
| InChIKey | NLTNRUPLQRDASK-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.43 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |