C16H26BrNS — CID 65005365
5-[2-(bromomethyl)-2-propylpentyl]-6,7-dihydro-4H-thieno[3,2-c]pyridine (PubChem CID 65005365) has the molecular formula C16H26BrNS and a molecular weight of 344.36 g/mol. Its IUPAC name is 5-[2-(bromomethyl)-2-propylpentyl]-6,7-dihydro-4H-thieno[3,2-c]pyridine.
| Compound Name | 5-[2-(bromomethyl)-2-propylpentyl]-6,7-dihydro-4H-thieno[3,2-c]pyridine |
|---|---|
| PubChem CID | 65005365 |
| Molecular Formula | C16H26BrNS |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | 5-[2-(bromomethyl)-2-propylpentyl]-6,7-dihydro-4H-thieno[3,2-c]pyridine |
| SMILES | CCCC(CBr)(CCC)CN1CCc2sccc2C1 |
| InChI | InChI=1S/C16H26BrNS/c1-3-7-16(12-17,8-4-2)13-18-9-5-15-14(11-18)6-10-19-15/h6,10H,3-5,7-9,11-13H2,1-2H3 |
| InChIKey | NLFJYQATEBRNCY-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|