C10H14INS — CID 130634537
5-(3-iodopropyl)-6,7-dihydro-4H-thieno[3,2-c]pyridine (PubChem CID 130634537) has the molecular formula C10H14INS and a molecular weight of 307.20 g/mol. Its IUPAC name is 5-(3-iodopropyl)-6,7-dihydro-4H-thieno[3,2-c]pyridine.
| Compound Name | 5-(3-iodopropyl)-6,7-dihydro-4H-thieno[3,2-c]pyridine |
|---|---|
| PubChem CID | 130634537 |
| Molecular Formula | C10H14INS |
| Molecular Weight | 307.20 g/mol |
| Exact Mass | 306.99 |
| IUPAC Name | 5-(3-iodopropyl)-6,7-dihydro-4H-thieno[3,2-c]pyridine |
| SMILES | ICCCN1CCc2sccc2C1 |
| InChI | InChI=1S/C10H14INS/c11-4-1-5-12-6-2-10-9(8-12)3-7-13-10/h3,7H,1-2,4-6,8H2 |
| InChIKey | AHUPWZLJXCVEOR-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.20 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|