C13H22N2S — CID 82853174
6-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)hexan-2-amine (PubChem CID 82853174) has the molecular formula C13H22N2S and a molecular weight of 238.40 g/mol. Its IUPAC name is 6-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)hexan-2-amine.
| Compound Name | 6-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)hexan-2-amine |
|---|---|
| PubChem CID | 82853174 |
| Molecular Formula | C13H22N2S |
| Molecular Weight | 238.40 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | 6-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)hexan-2-amine |
| SMILES | CC(N)CCCCN1CCc2sccc2C1 |
| InChI | InChI=1S/C13H22N2S/c1-11(14)4-2-3-7-15-8-5-13-12(10-15)6-9-16-13/h6,9,11H,2-5,7-8,10,14H2,1H3 |
| InChIKey | ZIANHIXIGBLBIZ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.40 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|