C16H19NS — CID 52551128
5-(3-phenylpropyl)-6,7-dihydro-4H-thieno[3,2-c]pyridine (PubChem CID 52551128) has the molecular formula C16H19NS and a molecular weight of 257.40 g/mol. Its IUPAC name is 5-(3-phenylpropyl)-6,7-dihydro-4H-thieno[3,2-c]pyridine.
| Compound Name | 5-(3-phenylpropyl)-6,7-dihydro-4H-thieno[3,2-c]pyridine |
|---|---|
| PubChem CID | 52551128 |
| Molecular Formula | C16H19NS |
| Molecular Weight | 257.40 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 5-(3-phenylpropyl)-6,7-dihydro-4H-thieno[3,2-c]pyridine |
| SMILES | c1ccc(CCCN2CCc3sccc3C2)cc1 |
| InChI | InChI=1S/C16H19NS/c1-2-5-14(6-3-1)7-4-10-17-11-8-16-15(13-17)9-12-18-16/h1-3,5-6,9,12H,4,7-8,10-11,13H2 |
| InChIKey | TUXMHMHNSPNROC-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.40 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |