C17H30N2S — CID 62263191
2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-ylmethyl)-2-methyl-N-propylpentan-1-amine (PubChem CID 62263191) has the molecular formula C17H30N2S and a molecular weight of 294.51 g/mol. Its IUPAC name is 2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-ylmethyl)-2-methyl-N-propylpentan-1-amine.
| Compound Name | 2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-ylmethyl)-2-methyl-N-propylpentan-1-amine |
|---|---|
| PubChem CID | 62263191 |
| Molecular Formula | C17H30N2S |
| Molecular Weight | 294.51 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | 2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-ylmethyl)-2-methyl-N-propylpentan-1-amine |
| SMILES | CCCNCC(C)(CCC)CN1CCc2sccc2C1 |
| InChI | InChI=1S/C17H30N2S/c1-4-8-17(3,13-18-9-5-2)14-19-10-6-16-15(12-19)7-11-20-16/h7,11,18H,4-6,8-10,12-14H2,1-3H3 |
| InChIKey | UHYQWGYKLNDOAC-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.51 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|