C10H16S — CID 142139297
ethane;4,5,6,7-tetrahydro-2-benzothiophene (PubChem CID 142139297) has the molecular formula C10H16S and a molecular weight of 168.31 g/mol. Its IUPAC name is ethane;4,5,6,7-tetrahydro-2-benzothiophene.
| Compound Name | ethane;4,5,6,7-tetrahydro-2-benzothiophene |
|---|---|
| PubChem CID | 142139297 |
| Molecular Formula | C10H16S |
| Molecular Weight | 168.31 g/mol |
| Exact Mass | 168.10 |
| IUPAC Name | ethane;4,5,6,7-tetrahydro-2-benzothiophene |
| SMILES | CC.c1scc2c1CCCC2 |
| InChI | InChI=1S/C8H10S.C2H6/c1-2-4-8-6-9-5-7(8)3-1;1-2/h5-6H,1-4H2;1-2H3 |
| InChIKey | QRTQNCJLACYLMF-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.31 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |