C10H15NS — CID 177018356
5-ethyl-6,7-dihydro-4H-1-benzothiophen-5-amine (PubChem CID 177018356) has the molecular formula C10H15NS and a molecular weight of 181.30 g/mol. Its IUPAC name is 5-ethyl-6,7-dihydro-4H-1-benzothiophen-5-amine.
| Compound Name | 5-ethyl-6,7-dihydro-4H-1-benzothiophen-5-amine |
|---|---|
| PubChem CID | 177018356 |
| Molecular Formula | C10H15NS |
| Molecular Weight | 181.30 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | 5-ethyl-6,7-dihydro-4H-1-benzothiophen-5-amine |
| SMILES | CCC1(N)CCc2sccc2C1 |
| InChI | InChI=1S/C10H15NS/c1-2-10(11)5-3-9-8(7-10)4-6-12-9/h4,6H,2-3,5,7,11H2,1H3 |
| InChIKey | WQGSJBLIGLCEEP-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.30 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |