C12H21NS — CID 167664571
butane;6-methyl-5,7-dihydro-4H-thieno[2,3-c]pyridine (PubChem CID 167664571) has the molecular formula C12H21NS and a molecular weight of 211.37 g/mol. Its IUPAC name is butane;6-methyl-5,7-dihydro-4H-thieno[2,3-c]pyridine.
| Compound Name | butane;6-methyl-5,7-dihydro-4H-thieno[2,3-c]pyridine |
|---|---|
| PubChem CID | 167664571 |
| Molecular Formula | C12H21NS |
| Molecular Weight | 211.37 g/mol |
| Exact Mass | 211.14 |
| IUPAC Name | butane;6-methyl-5,7-dihydro-4H-thieno[2,3-c]pyridine |
| SMILES | CCCC.CN1CCc2ccsc2C1 |
| InChI | InChI=1S/C8H11NS.C4H10/c1-9-4-2-7-3-5-10-8(7)6-9;1-3-4-2/h3,5H,2,4,6H2,1H3;3-4H2,1-2H3 |
| InChIKey | SLBCQYVSXDWEAO-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.37 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |