About 6-prop-1-en-2-yl-5,7-dihydro-4H-thieno[2,3-c]pyridine
6-prop-1-en-2-yl-5,7-dihydro-4H-thieno[2,3-c]pyridine (PubChem CID 70216021) has the molecular formula C10H13NS
and a molecular weight of 179.29 g/mol. Its IUPAC name is 6-prop-1-en-2-yl-5,7-dihydro-4H-thieno[2,3-c]pyridine.
Analyze 6-prop-1-en-2-yl-5,7-dihydro-4H-thieno[2,3-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-prop-1-en-2-yl-5,7-dihydro-4H-thieno[2,3-c]pyridine?
The IUPAC name of 6-prop-1-en-2-yl-5,7-dihydro-4H-thieno[2,3-c]pyridine (CID 70216021) is 6-prop-1-en-2-yl-5,7-dihydro-4H-thieno[2,3-c]pyridine.
What is the SMILES notation for 6-prop-1-en-2-yl-5,7-dihydro-4H-thieno[2,3-c]pyridine?
The canonical SMILES for 6-prop-1-en-2-yl-5,7-dihydro-4H-thieno[2,3-c]pyridine is C=C(C)N1CCc2ccsc2C1.
What is the InChIKey of 6-prop-1-en-2-yl-5,7-dihydro-4H-thieno[2,3-c]pyridine?
The InChIKey is XOXXSCHKEQEAEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NS/c1-8(2)11-5-3-9-4-6-12-10(9)7-11/h4,6H,1,3,5,7H2,2H3.
What are the key properties of 6-prop-1-en-2-yl-5,7-dihydro-4H-thieno[2,3-c]pyridine?
6-prop-1-en-2-yl-5,7-dihydro-4H-thieno[2,3-c]pyridine has a molecular weight of 179.29 g/mol, XLogP of 2.64, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-prop-1-en-2-yl-5,7-dihydro-4H-thieno[2,3-c]pyridine is sourced from PubChem (CID 70216021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).