C9H13NOS2 — CID 131043045
5-ethylsulfinyl-6,7-dihydro-4H-thieno[3,2-c]pyridine (PubChem CID 131043045) has the molecular formula C9H13NOS2 and a molecular weight of 215.34 g/mol. Its IUPAC name is 5-ethylsulfinyl-6,7-dihydro-4H-thieno[3,2-c]pyridine.
| Compound Name | 5-ethylsulfinyl-6,7-dihydro-4H-thieno[3,2-c]pyridine |
|---|---|
| PubChem CID | 131043045 |
| Molecular Formula | C9H13NOS2 |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.04 |
| IUPAC Name | 5-ethylsulfinyl-6,7-dihydro-4H-thieno[3,2-c]pyridine |
| SMILES | CCS(=O)N1CCc2sccc2C1 |
| InChI | InChI=1S/C9H13NOS2/c1-2-13(11)10-5-3-9-8(7-10)4-6-12-9/h4,6H,2-3,5,7H2,1H3 |
| InChIKey | YNVUBWRDEOGHCQ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |