C14H18OS2 — CID 159034398
6,7-dihydro-4H-thieno[3,2-c]pyran;2-propylthiophene (PubChem CID 159034398) has the molecular formula C14H18OS2 and a molecular weight of 266.43 g/mol. Its IUPAC name is 6,7-dihydro-4H-thieno[3,2-c]pyran;2-propylthiophene.
| Compound Name | 6,7-dihydro-4H-thieno[3,2-c]pyran;2-propylthiophene |
|---|---|
| PubChem CID | 159034398 |
| Molecular Formula | C14H18OS2 |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | 6,7-dihydro-4H-thieno[3,2-c]pyran;2-propylthiophene |
| SMILES | CCCc1cccs1.c1cc2c(s1)CCOC2 |
| InChI | InChI=1S/C7H8OS.C7H10S/c1-3-8-5-6-2-4-9-7(1)6;1-2-4-7-5-3-6-8-7/h2,4H,1,3,5H2;3,5-6H,2,4H2,1H3 |
| InChIKey | JVGYCTQVRZGCLQ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |