C16H16N2 — CID 165098616
4,7-dihydro-1H-indole;3H-indole (PubChem CID 165098616) has the molecular formula C16H16N2 and a molecular weight of 236.32 g/mol. Its IUPAC name is 4,7-dihydro-1H-indole;3H-indole.
| Compound Name | 4,7-dihydro-1H-indole;3H-indole |
|---|---|
| PubChem CID | 165098616 |
| Molecular Formula | C16H16N2 |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 4,7-dihydro-1H-indole;3H-indole |
| SMILES | C1=CCc2[nH]ccc2C1.C1=Nc2ccccc2C1 |
| InChI | InChI=1S/C8H9N.C8H7N/c2*1-2-4-8-7(3-1)5-6-9-8/h1-2,5-6,9H,3-4H2;1-4,6H,5H2 |
| InChIKey | XXYZKFGHTONLAV-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 28.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|