C9H9N — CID 175978097
4,4-dideuterio-3H-quinoline (PubChem CID 175978097) has the molecular formula C9H9N and a molecular weight of 133.19 g/mol. Its IUPAC name is 4,4-dideuterio-3H-quinoline.
| Compound Name | 4,4-dideuterio-3H-quinoline |
|---|---|
| PubChem CID | 175978097 |
| Molecular Formula | C9H9N |
| Molecular Weight | 133.19 g/mol |
| Exact Mass | 133.09 |
| IUPAC Name | 4,4-dideuterio-3H-quinoline |
| SMILES | [2H]C1([2H])CC=Nc2ccccc21 |
| InChI | InChI=1S/C9H9N/c1-2-6-9-8(4-1)5-3-7-10-9/h1-2,4,6-7H,3,5H2/i5D2 |
| InChIKey | DNNVRTZJRKIUFK-BFWBPSQCSA-N |
| XLogP | 2.34 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 133.19 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |