C11H11NO — CID 131878649
3,4-dihydro-1-benzazocin-5-ol (PubChem CID 131878649) has the molecular formula C11H11NO and a molecular weight of 173.22 g/mol. Its IUPAC name is 3,4-dihydro-1-benzazocin-5-ol.
| Compound Name | 3,4-dihydro-1-benzazocin-5-ol |
|---|---|
| PubChem CID | 131878649 |
| Molecular Formula | C11H11NO |
| Molecular Weight | 173.22 g/mol |
| Exact Mass | 173.08 |
| IUPAC Name | 3,4-dihydro-1-benzazocin-5-ol |
| SMILES | OC1=Cc2ccccc2/N=C\CC1 |
| InChI | InChI=1S/C11H11NO/c13-10-5-3-7-12-11-6-2-1-4-9(11)8-10/h1-2,4,6-8,13H,3,5H2/b10-8?,12-7- |
| InChIKey | PPEIOJOSPKOCAE-UIOPMXKISA-N |
| XLogP | 3.08 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.22 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |