C10H11NO2 — CID 87881763
4,5-dihydro-3H-1-benzazepine-7,8-diol (PubChem CID 87881763) has the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. Its IUPAC name is 4,5-dihydro-3H-1-benzazepine-7,8-diol.
| Compound Name | 4,5-dihydro-3H-1-benzazepine-7,8-diol |
|---|---|
| PubChem CID | 87881763 |
| Molecular Formula | C10H11NO2 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | 4,5-dihydro-3H-1-benzazepine-7,8-diol |
| SMILES | Oc1cc2c(cc1O)N=CCCC2 |
| InChI | InChI=1S/C10H11NO2/c12-9-5-7-3-1-2-4-11-8(7)6-10(9)13/h4-6,12-13H,1-3H2 |
| InChIKey | DYJPCDLVFHWUCU-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|