C11H12ClNO — CID 142897885
6-chloro-8-methyl-4,5-dihydro-3H-1-benzazepin-9-ol (PubChem CID 142897885) has the molecular formula C11H12ClNO and a molecular weight of 209.68 g/mol. Its IUPAC name is 6-chloro-8-methyl-4,5-dihydro-3H-1-benzazepin-9-ol.
| Compound Name | 6-chloro-8-methyl-4,5-dihydro-3H-1-benzazepin-9-ol |
|---|---|
| PubChem CID | 142897885 |
| Molecular Formula | C11H12ClNO |
| Molecular Weight | 209.68 g/mol |
| Exact Mass | 209.06 |
| IUPAC Name | 6-chloro-8-methyl-4,5-dihydro-3H-1-benzazepin-9-ol |
| SMILES | Cc1cc(Cl)c2c(c1O)N=CCCC2 |
| InChI | InChI=1S/C11H12ClNO/c1-7-6-9(12)8-4-2-3-5-13-10(8)11(7)14/h5-6,14H,2-4H2,1H3 |
| InChIKey | DKKXAJCSOSMKKR-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.68 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |