C15H20O2 — CID 54105253
3,8-dimethyl-5-propan-2-yl-6,7-dihydronaphthalene-1,2-diol (PubChem CID 54105253) has the molecular formula C15H20O2 and a molecular weight of 232.32 g/mol. Its IUPAC name is 3,8-dimethyl-5-propan-2-yl-6,7-dihydronaphthalene-1,2-diol.
| Compound Name | 3,8-dimethyl-5-propan-2-yl-6,7-dihydronaphthalene-1,2-diol |
|---|---|
| PubChem CID | 54105253 |
| Molecular Formula | C15H20O2 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.15 |
| IUPAC Name | 3,8-dimethyl-5-propan-2-yl-6,7-dihydronaphthalene-1,2-diol |
| SMILES | CC1=c2c(O)c(O)c(C)cc2=C(C(C)C)CC1 |
| InChI | InChI=1S/C15H20O2/c1-8(2)11-6-5-9(3)13-12(11)7-10(4)14(16)15(13)17/h7-8,16-17H,5-6H2,1-4H3 |
| InChIKey | NDHGBQSBZGNKAY-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|