C9H15NO — CID 171832855
6-methoxy-5-propan-2-yl-3,4-dihydropyridine (PubChem CID 171832855) has the molecular formula C9H15NO and a molecular weight of 153.22 g/mol. Its IUPAC name is 6-methoxy-5-propan-2-yl-3,4-dihydropyridine.
| Compound Name | 6-methoxy-5-propan-2-yl-3,4-dihydropyridine |
|---|---|
| PubChem CID | 171832855 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | 6-methoxy-5-propan-2-yl-3,4-dihydropyridine |
| SMILES | COC1=C(C(C)C)CCC=N1 |
| InChI | InChI=1S/C9H15NO/c1-7(2)8-5-4-6-10-9(8)11-3/h6-7H,4-5H2,1-3H3 |
| InChIKey | YONZPSKJHMWPAJ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |