C14H24 — CID 153335086
2-ethyl-1,3-di(propan-2-yl)cyclohexa-1,3-diene (PubChem CID 153335086) has the molecular formula C14H24 and a molecular weight of 192.35 g/mol. Its IUPAC name is 2-ethyl-1,3-di(propan-2-yl)cyclohexa-1,3-diene.
| Compound Name | 2-ethyl-1,3-di(propan-2-yl)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 153335086 |
| Molecular Formula | C14H24 |
| Molecular Weight | 192.35 g/mol |
| Exact Mass | 192.19 |
| IUPAC Name | 2-ethyl-1,3-di(propan-2-yl)cyclohexa-1,3-diene |
| SMILES | CCC1=C(C(C)C)CCC=C1C(C)C |
| InChI | InChI=1S/C14H24/c1-6-12-13(10(2)3)8-7-9-14(12)11(4)5/h8,10-11H,6-7,9H2,1-5H3 |
| InChIKey | PWMZPURHUMHVOT-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.35 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |