C11H18S — CID 145375515
2-ethylsulfanyl-1-propan-2-ylcyclohexa-1,3-diene (PubChem CID 145375515) has the molecular formula C11H18S and a molecular weight of 182.33 g/mol. Its IUPAC name is 2-ethylsulfanyl-1-propan-2-ylcyclohexa-1,3-diene.
| Compound Name | 2-ethylsulfanyl-1-propan-2-ylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 145375515 |
| Molecular Formula | C11H18S |
| Molecular Weight | 182.33 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | 2-ethylsulfanyl-1-propan-2-ylcyclohexa-1,3-diene |
| SMILES | CCSC1=C(C(C)C)CCC=C1 |
| InChI | InChI=1S/C11H18S/c1-4-12-11-8-6-5-7-10(11)9(2)3/h6,8-9H,4-5,7H2,1-3H3 |
| InChIKey | HWDLWCUKLHPJIY-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.33 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |