C15H20 — CID 144871822
6-ethyl-7-propan-2-yl-1,2-dihydronaphthalene (PubChem CID 144871822) has the molecular formula C15H20 and a molecular weight of 200.32 g/mol. Its IUPAC name is 6-ethyl-7-propan-2-yl-1,2-dihydronaphthalene.
| Compound Name | 6-ethyl-7-propan-2-yl-1,2-dihydronaphthalene |
|---|---|
| PubChem CID | 144871822 |
| Molecular Formula | C15H20 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.16 |
| IUPAC Name | 6-ethyl-7-propan-2-yl-1,2-dihydronaphthalene |
| SMILES | CCc1cc2c(cc1C(C)C)CCC=C2 |
| InChI | InChI=1S/C15H20/c1-4-12-9-13-7-5-6-8-14(13)10-15(12)11(2)3/h5,7,9-11H,4,6,8H2,1-3H3 |
| InChIKey | FTEGVUCSFMVOSB-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |