C10H11NO — CID 163497174
3-amino-5,6-dihydronaphthalen-2-ol (PubChem CID 163497174) has the molecular formula C10H11NO and a molecular weight of 161.20 g/mol. Its IUPAC name is 3-amino-5,6-dihydronaphthalen-2-ol.
| Compound Name | 3-amino-5,6-dihydronaphthalen-2-ol |
|---|---|
| PubChem CID | 163497174 |
| Molecular Formula | C10H11NO |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.08 |
| IUPAC Name | 3-amino-5,6-dihydronaphthalen-2-ol |
| SMILES | Nc1cc2c(cc1O)C=CCC2 |
| InChI | InChI=1S/C10H11NO/c11-9-5-7-3-1-2-4-8(7)6-10(9)12/h2,4-6,12H,1,3,11H2 |
| InChIKey | CRSCXGPUDPUAGT-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|