C12H14O — CID 131969381
1-(5,6-dihydronaphthalen-2-yl)ethanol (PubChem CID 131969381) has the molecular formula C12H14O and a molecular weight of 174.24 g/mol. Its IUPAC name is 1-(5,6-dihydronaphthalen-2-yl)ethanol.
| Compound Name | 1-(5,6-dihydronaphthalen-2-yl)ethanol |
|---|---|
| PubChem CID | 131969381 |
| Molecular Formula | C12H14O |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.10 |
| IUPAC Name | 1-(5,6-dihydronaphthalen-2-yl)ethanol |
| SMILES | CC(O)c1ccc2c(c1)C=CCC2 |
| InChI | InChI=1S/C12H14O/c1-9(13)11-7-6-10-4-2-3-5-12(10)8-11/h3,5-9,13H,2,4H2,1H3 |
| InChIKey | JJUIWLXYPXUDJL-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |