C21H25NO3 — CID 145300139
4-[2-[1-(5,6-dihydronaphthalen-2-yl)propan-2-ylamino]-1-hydroxyethyl]benzene-1,2-diol (PubChem CID 145300139) has the molecular formula C21H25NO3 and a molecular weight of 339.44 g/mol. Its IUPAC name is 4-[2-[1-(5,6-dihydronaphthalen-2-yl)propan-2-ylamino]-1-hydroxyethyl]benzene-1,2-diol.
| Compound Name | 4-[2-[1-(5,6-dihydronaphthalen-2-yl)propan-2-ylamino]-1-hydroxyethyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 145300139 |
| Molecular Formula | C21H25NO3 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | 4-[2-[1-(5,6-dihydronaphthalen-2-yl)propan-2-ylamino]-1-hydroxyethyl]benzene-1,2-diol |
| SMILES | CC(Cc1ccc2c(c1)C=CCC2)NCC(O)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C21H25NO3/c1-14(10-15-6-7-16-4-2-3-5-17(16)11-15)22-13-21(25)18-8-9-19(23)20(24)12-18/h3,5-9,11-12,14,21-25H,2,4,10,13H2,1H3 |
| InChIKey | KEZQAEWNKYFJCC-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|