C18H23NO4 — CID 165341747
4-[1-hydroxy-2-[1-(4-hydroxyphenyl)propan-2-ylamino]ethyl]-2-(hydroxymethyl)phenol (PubChem CID 165341747) has the molecular formula C18H23NO4 and a molecular weight of 317.39 g/mol. Its IUPAC name is 4-[1-hydroxy-2-[1-(4-hydroxyphenyl)propan-2-ylamino]ethyl]-2-(hydroxymethyl)phenol.
| Compound Name | 4-[1-hydroxy-2-[1-(4-hydroxyphenyl)propan-2-ylamino]ethyl]-2-(hydroxymethyl)phenol |
|---|---|
| PubChem CID | 165341747 |
| Molecular Formula | C18H23NO4 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | 4-[1-hydroxy-2-[1-(4-hydroxyphenyl)propan-2-ylamino]ethyl]-2-(hydroxymethyl)phenol |
| SMILES | CC(Cc1ccc(O)cc1)NCC(O)c1ccc(O)c(CO)c1 |
| InChI | InChI=1S/C18H23NO4/c1-12(8-13-2-5-16(21)6-3-13)19-10-18(23)14-4-7-17(22)15(9-14)11-20/h2-7,9,12,18-23H,8,10-11H2,1H3 |
| InChIKey | RBPLCNGSLUJXCG-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 92.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |