C27H33NO5 — CID 10195165
2-(hydroxymethyl)-4-[(1R)-1-hydroxy-2-[[(2R)-1-[4-(2-phenylmethoxyethoxy)phenyl]propan-2-yl]amino]ethyl]phenol (PubChem CID 10195165) has the molecular formula C27H33NO5 and a molecular weight of 451.56 g/mol. Its IUPAC name is 2-(hydroxymethyl)-4-[(1R)-1-hydroxy-2-[[(2R)-1-[4-(2-phenylmethoxyethoxy)phenyl]propan-2-yl]amino]ethyl]phenol.
| Compound Name | 2-(hydroxymethyl)-4-[(1R)-1-hydroxy-2-[[(2R)-1-[4-(2-phenylmethoxyethoxy)phenyl]propan-2-yl]amino]ethyl]phenol |
|---|---|
| PubChem CID | 10195165 |
| Molecular Formula | C27H33NO5 |
| Molecular Weight | 451.56 g/mol |
| Exact Mass | 451.24 |
| IUPAC Name | 2-(hydroxymethyl)-4-[(1R)-1-hydroxy-2-[[(2R)-1-[4-(2-phenylmethoxyethoxy)phenyl]propan-2-yl]amino]ethyl]phenol |
| SMILES | C[C@H](Cc1ccc(OCCOCc2ccccc2)cc1)NC[C@H](O)c1ccc(O)c(CO)c1 |
| InChI | InChI=1S/C27H33NO5/c1-20(28-17-27(31)23-9-12-26(30)24(16-23)18-29)15-21-7-10-25(11-8-21)33-14-13-32-19-22-5-3-2-4-6-22/h2-12,16,20,27-31H,13-15,17-19H2,1H3/t20-,27+/m1/s1 |
| InChIKey | JEWPRFHZTUZKJG-HRFSGMKKSA-N |
| XLogP | 3.73 |
| TPSA | 91.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.56 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|