C11H15Cl2NO3 — CID 124561880
4-[(1R)-2-[[(2R)-1,1-dichloropropan-2-yl]amino]-1-hydroxyethyl]benzene-1,2-diol (PubChem CID 124561880) has the molecular formula C11H15Cl2NO3 and a molecular weight of 280.15 g/mol. Its IUPAC name is 4-[(1R)-2-[[(2R)-1,1-dichloropropan-2-yl]amino]-1-hydroxyethyl]benzene-1,2-diol.
| Compound Name | 4-[(1R)-2-[[(2R)-1,1-dichloropropan-2-yl]amino]-1-hydroxyethyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 124561880 |
| Molecular Formula | C11H15Cl2NO3 |
| Molecular Weight | 280.15 g/mol |
| Exact Mass | 279.04 |
| IUPAC Name | 4-[(1R)-2-[[(2R)-1,1-dichloropropan-2-yl]amino]-1-hydroxyethyl]benzene-1,2-diol |
| SMILES | C[C@@H](NC[C@H](O)c1ccc(O)c(O)c1)C(Cl)Cl |
| InChI | InChI=1S/C11H15Cl2NO3/c1-6(11(12)13)14-5-10(17)7-2-3-8(15)9(16)4-7/h2-4,6,10-11,14-17H,5H2,1H3/t6-,10+/m1/s1 |
| InChIKey | CLQDDCYCLSEGQD-LDWIPMOCSA-N |
| XLogP | 1.91 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.15 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|