C14H18 — CID 162529552
7-(2-methylpropyl)-1,2-dihydronaphthalene (PubChem CID 162529552) has the molecular formula C14H18 and a molecular weight of 186.30 g/mol. Its IUPAC name is 7-(2-methylpropyl)-1,2-dihydronaphthalene.
| Compound Name | 7-(2-methylpropyl)-1,2-dihydronaphthalene |
|---|---|
| PubChem CID | 162529552 |
| Molecular Formula | C14H18 |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | 7-(2-methylpropyl)-1,2-dihydronaphthalene |
| SMILES | CC(C)Cc1ccc2c(c1)CCC=C2 |
| InChI | InChI=1S/C14H18/c1-11(2)9-12-7-8-13-5-3-4-6-14(13)10-12/h3,5,7-8,10-11H,4,6,9H2,1-2H3 |
| InChIKey | XFYAEYUTFPNKKV-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |