About 6-(3-bromophenyl)-1,2-dihydronaphthalene
6-(3-bromophenyl)-1,2-dihydronaphthalene (PubChem CID 143742430) has the molecular formula C16H13Br
and a molecular weight of 285.18 g/mol. Its IUPAC name is 6-(3-bromophenyl)-1,2-dihydronaphthalene.
Molecular Properties
| Compound Name | 6-(3-bromophenyl)-1,2-dihydronaphthalene |
| PubChem CID | 143742430 |
| Molecular Formula | C16H13Br |
| Molecular Weight | 285.18 g/mol |
| Exact Mass | 284.02 |
| IUPAC Name | 6-(3-bromophenyl)-1,2-dihydronaphthalene |
| SMILES | Brc1cccc(-c2ccc3c(c2)C=CCC3)c1 |
| InChI | InChI=1S/C16H13Br/c17-16-7-3-6-14(11-16)15-9-8-12-4-1-2-5-13(12)10-15/h2-3,5-11H,1,4H2 |
| InChIKey | BQCQCZVVBMDPHS-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 285.18 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 6-(3-bromophenyl)-1,2-dihydronaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3-bromophenyl)-1,2-dihydronaphthalene?
The IUPAC name of 6-(3-bromophenyl)-1,2-dihydronaphthalene (CID 143742430) is 6-(3-bromophenyl)-1,2-dihydronaphthalene.
What is the SMILES notation for 6-(3-bromophenyl)-1,2-dihydronaphthalene?
The canonical SMILES for 6-(3-bromophenyl)-1,2-dihydronaphthalene is Brc1cccc(-c2ccc3c(c2)C=CCC3)c1.
What is the InChIKey of 6-(3-bromophenyl)-1,2-dihydronaphthalene?
The InChIKey is BQCQCZVVBMDPHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13Br/c17-16-7-3-6-14(11-16)15-9-8-12-4-1-2-5-13(12)10-15/h2-3,5-11H,1,4H2.
What are the key properties of 6-(3-bromophenyl)-1,2-dihydronaphthalene?
6-(3-bromophenyl)-1,2-dihydronaphthalene has a molecular weight of 285.18 g/mol, XLogP of 5.08, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3-bromophenyl)-1,2-dihydronaphthalene is sourced from PubChem (CID 143742430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).