C16H13Br — CID 143742430
6-(3-bromophenyl)-1,2-dihydronaphthalene (PubChem CID 143742430) has the molecular formula C16H13Br and a molecular weight of 285.18 g/mol. Its IUPAC name is 6-(3-bromophenyl)-1,2-dihydronaphthalene.
| Compound Name | 6-(3-bromophenyl)-1,2-dihydronaphthalene |
|---|---|
| PubChem CID | 143742430 |
| Molecular Formula | C16H13Br |
| Molecular Weight | 285.18 g/mol |
| Exact Mass | 284.02 |
| IUPAC Name | 6-(3-bromophenyl)-1,2-dihydronaphthalene |
| SMILES | Brc1cccc(-c2ccc3c(c2)C=CCC3)c1 |
| InChI | InChI=1S/C16H13Br/c17-16-7-3-6-14(11-16)15-9-8-12-4-1-2-5-13(12)10-15/h2-3,5-11H,1,4H2 |
| InChIKey | BQCQCZVVBMDPHS-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.18 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |